FL1AUNNF0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1AUN Unusual core aurone (3 pages) : FL1AUNNF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61755-71-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1AUNNF0001.mol |
| Derriobtusone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Benzoyl-3-methoxybenzo [ 1,2-b:3,4-b' ] difuran |
| Common Name |
|
| Symbol | |
| Formula | C18H12O4 |
| Exact Mass | 292.073558872 |
| Average Mass | 292.28548 |
| SMILES | c(c14)(occ4)ccc(c2OC)c(oc(C(=O)c(c3)cccc3)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
