FL7AADNS0001
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=3,5,7,4'-Tetrahydroxy-3'-methoxyflavylium |Common Name=&&Peonidin&&3,4',5,7-Tetrahydroxy-3'-methoxyflavylium&& |CAS=134-01-0 |KNApSAcK= }}) |
Latest revision as of 11:59, 24 December 2009
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL7 Anthocyani(di)n : FL7A Anthocyani(di)n : FL7AAD Peonidin (38 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 134-01-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AADNS0001.mol |
| Peonidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxy-3'-methoxyflavylium |
| Common Name |
|
| Symbol | |
| Formula | C16H13O6 |
| Exact Mass | 301.07121314799997 |
| Average Mass | 301.27081999999996 |
| SMILES | COc(c(O)3)cc(cc3)c([o+1]1)c(O)cc(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
