FL63ACNC0006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(-)-Amurensisin | + | |SysName=(-)-Amurensisin |
|Common Name=&&(-)-Amurensisin&&Amurensisin&&2-[(2R,3R)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl]-4,8,9,10-tetrahydroxy-6H-Dibenzo[b,d]pyran-6-one&& | |Common Name=&&(-)-Amurensisin&&Amurensisin&&2-[(2R,3R)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl]-4,8,9,10-tetrahydroxy-6H-Dibenzo[b,d]pyran-6-one&& | ||
|CAS=280576-19-4 | |CAS=280576-19-4 | ||
|KNApSAcK=C00013257 | |KNApSAcK=C00013257 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 280576-19-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63ACNC0006.mol |
| (-)-Amurensisin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (-)-Amurensisin |
| Common Name |
|
| Symbol | |
| Formula | C22H16O10 |
| Exact Mass | 440.074346732 |
| Average Mass | 440.35644 |
| SMILES | O(c12)C(c(c5)cc(c34)c(c(O)5)OC(c3cc(c(c4O)O)O)=O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
