FL5FDDNS0003
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=5-Hydroxy-2- (4-hydroxy-3-methoxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,4'-Dihydroxy-3,7,3'-trimethoxyflavone | + | |Common Name=&&Pachypodol&&5,4'-Dihydroxy-3,7,3'-trimethoxyflavone&&Quercetin 3,3',7-trimethyl ether&& |
|CAS=33708-72-4 | |CAS=33708-72-4 | ||
|KNApSAcK=C00004646 | |KNApSAcK=C00004646 | ||
}} | }} | ||
Latest revision as of 17:17, 2 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDD Quercetin O-methyl derivatives (4'-hydroxy-3'-methoxy, without FL5FAD, FL5FBD, FL5FCD) (21 pages) : FL5FDDNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 33708-72-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDDNS0003.mol |
| Pachypodol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxy-3-methoxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c21)(O)cc(OC)cc(OC(c(c3)cc(OC)c(O)c3)=C(C2=O)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
