FL5FCCNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Rhamnetin | + | |SysName=Rhamnetin |
|Common Name=&&Rhamnetin&&3,5,3',4'-Tetrahydroxy-7-methoxyflavone&&7-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1- benzopyran-4-one&& | |Common Name=&&Rhamnetin&&3,5,3',4'-Tetrahydroxy-7-methoxyflavone&&7-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1- benzopyran-4-one&& | ||
|CAS=90-19-7 | |CAS=90-19-7 | ||
|KNApSAcK=C00004634 | |KNApSAcK=C00004634 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 90-19-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FCCNS0001.mol |
Rhamnetin | |
---|---|
Structural Information | |
Systematic Name | Rhamnetin |
Common Name |
|
Symbol | |
Formula | C16H12O7 |
Exact Mass | 316.058302738 |
Average Mass | 316.26228000000003 |
SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(O)=C1c(c2)cc(O)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |