FL3FCBNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Apigenin 7,4'-dimethyl ether | + | |SysName=Apigenin 7,4'-dimethyl ether |
|Common Name=&&Apigenin 7,4'-dimethyl ether&&5-Hydroxy-4',7-dimethoxyflavone&&Genkwanin 4'-methyl ether&&7-O-Methylacacetin&&Acacetin 7-methyl ether&&5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Apigenin 7,4'-dimethyl ether&&5-Hydroxy-4',7-dimethoxyflavone&&Genkwanin 4'-methyl ether&&7-O-Methylacacetin&&Acacetin 7-methyl ether&&5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=5128-44-9 | |CAS=5128-44-9 | ||
|KNApSAcK=C00001016 | |KNApSAcK=C00001016 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 5128-44-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FCBNS0001.mol |
Apigenin 7,4'-dimethyl ether | |
---|---|
Structural Information | |
Systematic Name | Apigenin 7,4'-dimethyl ether |
Common Name |
|
Symbol | |
Formula | C17H14O5 |
Exact Mass | 298.084123558 |
Average Mass | 298.29006 |
SMILES | COc(c3)ccc(c3)C(=C1)Oc(c2)c(c(O)cc(OC)2)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |