FL1B19NF0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=2,3-Dihydro-2,3-dimethoxy-2- (phenylmethyl) benzo [ 1,2-b:3,4-b' ] difuran | |SysName=2,3-Dihydro-2,3-dimethoxy-2- (phenylmethyl) benzo [ 1,2-b:3,4-b' ] difuran | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1B Auronol : FL1B19 6,(3'),(5')-Hydroxyauronol and O-methyl derivatives (1 pages) : FL1B19NF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 126585-61-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1B19NF0002.mol |
| Castillene B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,3-Dihydro-2,3-dimethoxy-2- (phenylmethyl) benzo [ 1,2-b:3,4-b' ] difuran |
| Common Name |
|
| Symbol | |
| Formula | C19H18O4 |
| Exact Mass | 310.120509064 |
| Average Mass | 310.34382 |
| SMILES | C(C(O4)(C(c(c43)ccc(c32)occ2)OC)OC)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
