FL63AJNS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=(2R)-2alpha-(3,5-Dihydroxy-4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-3alpha,5,7-triol |
|Common Name=&&Ourateacatechin&& | |Common Name=&&Ourateacatechin&& | ||
|CAS=17291-05-3 | |CAS=17291-05-3 | ||
|KNApSAcK=C00008820 | |KNApSAcK=C00008820 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 17291-05-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL63AJNS0002.mol |
Ourateacatechin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C16H16O7 |
Exact Mass | 320.089602866 |
Average Mass | 320.29404 |
SMILES | COc(c(O)3)c(O)cc(c3)C(O1)C(O)Cc(c(O)2)c(cc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |