FL5FDCNS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-Dihydroxyphenyl) -5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,3',4'-Trihydroxy-3,7-dimethoxyflavone&&Quercetin 3,7-dimethyl ether&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,3',4'-Trihydroxy-3,7-dimethoxyflavone&&Quercetin 3,7-dimethyl ether&&2- (3,4-Dihydroxyphenyl) -5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=2068-02-2 | |CAS=2068-02-2 | ||
|KNApSAcK=C00004638 | |KNApSAcK=C00004638 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2068-02-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDCNS0003.mol |
| 5,3',4'-Trihydroxy-3,7-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(OC)=C1c(c2)cc(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
