FL4DA9NS0007
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R,3S)-3,5,7-Trihydroxyflavanone 3-acetate | + | |SysName= (2R,3S) -3,5,7-Trihydroxyflavanone 3-acetate |
| − | |Common Name=&&(2R,3S)-Pinobanksin 3-acetate&&(2R,3S)-3,5,7-Trihydroxyflavanone 3-acetate&& | + | |Common Name=&& (2R,3S) -Pinobanksin 3-acetate&& (2R,3S) -3,5,7-Trihydroxyflavanone 3-acetate&& |
|CAS=102092-27-3 | |CAS=102092-27-3 | ||
|KNApSAcK=C00008732 | |KNApSAcK=C00008732 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102092-27-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DA9NS0007.mol |
| (2R,3S) -Pinobanksin 3-acetate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3S) -3,5,7-Trihydroxyflavanone 3-acetate |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | CC(=O)OC(C(=O)2)C(Oc(c3)c(c(O)cc(O)3)2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
