FL4DA9NS0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=(2R,3R)-3,5,7-Trihydroxyflavanone 3-acetate |
|Common Name=&&(2R,3R)-Pinobanksin 3-acetate&& | |Common Name=&&(2R,3R)-Pinobanksin 3-acetate&& | ||
|CAS=52117-69-8 | |CAS=52117-69-8 | ||
|KNApSAcK=C00008731 | |KNApSAcK=C00008731 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 52117-69-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DA9NS0006.mol |
(2R,3R)-Pinobanksin 3-acetate | |
---|---|
Structural Information | |
Systematic Name | (2R,3R)-3,5,7-Trihydroxyflavanone 3-acetate |
Common Name |
|
Symbol | |
Formula | C17H14O6 |
Exact Mass | 314.07903818 |
Average Mass | 314.28945999999996 |
SMILES | CC(=O)OC(C(=O)2)C(Oc(c3)c(c(O)cc(O)3)2)c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |