FL4DA9NS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2R)-2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one | + | |SysName= (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one |
− | |Common Name=&&Pinobanksin&&(2R)-2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one&& | + | |Common Name=&&Pinobanksin&& (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one&& |
|CAS=548-82-3 | |CAS=548-82-3 | ||
|KNApSAcK=C00000991 | |KNApSAcK=C00000991 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 548-82-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DA9NS0001.mol |
Pinobanksin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C15H12O5 |
Exact Mass | 272.068473494 |
Average Mass | 272.25278000000003 |
SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C([H])(O)C([H])1c(c2)cccc |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |