FL1DCANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=1-(2,6-Dihydroxy-4-methoxyphenyl)-3-(4-hydroxyphenyl)-1-propanone | + | |SysName=1- (2,6-Dihydroxy-4-methoxyphenyl) -3- (4-hydroxyphenyl) -1-propanone |
| − | |Common Name=&&Asebogenin&&1-(2,6-Dihydroxy-4-methoxyphenyl)-3-(4-hydroxyphenyl)-1-propanone&& | + | |Common Name=&&Asebogenin&&1- (2,6-Dihydroxy-4-methoxyphenyl) -3- (4-hydroxyphenyl) -1-propanone&& |
|CAS=520-42-3 | |CAS=520-42-3 | ||
|KNApSAcK=C00000940 | |KNApSAcK=C00000940 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-42-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DCANS0001.mol |
| Asebogenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (2,6-Dihydroxy-4-methoxyphenyl) -3- (4-hydroxyphenyl) -1-propanone |
| Common Name |
|
| Symbol | |
| Formula | C16H16O5 |
| Exact Mass | 288.099773622 |
| Average Mass | 288.29524 |
| SMILES | COc(c1)cc(O)c(C(=O)CCc(c2)ccc(O)c2)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
