FLIE1LNS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Wairol | + | |SysName=Wairol |
|Common Name=&&Wairol&&3-Hydroxy-7,9-dimethoxycoumestan&&7-Hydroxy-10,12-dimethoxycoumestan&& | |Common Name=&&Wairol&&3-Hydroxy-7,9-dimethoxycoumestan&&7-Hydroxy-10,12-dimethoxycoumestan&& | ||
|CAS=77331-73-8 | |CAS=77331-73-8 | ||
|KNApSAcK=C00009767 | |KNApSAcK=C00009767 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 77331-73-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIE1LNS0003.mol |
Wairol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Wairol |
Common Name |
|
Symbol | |
Formula | C17H12O6 |
Exact Mass | 312.063388116 |
Average Mass | 312.27358 |
SMILES | COc(c4)cc(o1)c(c(OC)4)c(C(=O)2)c1c(c3)c(cc(O)c3)O2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|