FL7AAHGL0012
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=??3,5,7,3',4'-Pentahydroxy-5'-methoxyflavylium 3-(4"'-p-coumarylrutinoside) |
|Common Name=&&Petunidin 3-(4"'-p-coumarylrutinoside)&& | |Common Name=&&Petunidin 3-(4"'-p-coumarylrutinoside)&& | ||
|CAS=69896-02-2 | |CAS=69896-02-2 | ||
|KNApSAcK=C00006897 | |KNApSAcK=C00006897 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 69896-02-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL7AAHGL0012.mol |
Petunidin 3-(4"'-p-coumarylrutinoside) | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C37H39O18 |
Exact Mass | 771.213639444 |
Average Mass | 771.69476 |
SMILES | c(c6)(c([o+1]c(c65)cc(O)cc5O)c(c4)cc(c(c(O)4)O)OC) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|