FL3FECNS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one |
|Common Name=&&Eupatilin&&2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Eupatilin&&2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | ||
|CAS=22368-21-4 | |CAS=22368-21-4 | ||
|KNApSAcK=C00003845 | |KNApSAcK=C00003845 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 22368-21-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FECNS0002.mol |
Eupatilin | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(c1OC)(O)cc(O2)c(C(=O)C=C2c(c3)cc(OC)c(OC)c3)c1O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |