FL5FACGL0015
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (3,4-Dihydroxyphenyl) -3,7-bis (beta-D-glucopyranosyloxy) -5-hydroxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Quercetin 3,7-diglucoside&& | + | |Common Name=&&Quercetin 3,7-diglucoside&&2- (3,4-Dihydroxyphenyl) -3,7-bis (beta-D-glucopyranosyloxy) -5-hydroxy-4H-1-benzopyran-4-one&& |
|CAS=6892-74-6 | |CAS=6892-74-6 | ||
|KNApSAcK=C00005427 | |KNApSAcK=C00005427 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAC Quercetin (289 pages) : FL5FACGL 3-Glucoside and related (79 pages) : FL5FACGL0 Normal (78 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6892-74-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGL0015.mol |
| Quercetin 3,7-diglucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -3,7-bis (beta-D-glucopyranosyloxy) -5-hydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C27H30O17 |
| Exact Mass | 626.148299534 |
| Average Mass | 626.5169000000001 |
| SMILES | O=C(c31)C(O[C@@H](C(O)5)O[C@@H]([C@@H](C(O)5)O)CO) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
