FL2FCANS0001
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-2,3-Dihydro-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | + | |SysName= (S) -2,3-Dihydro-5-hydroxy-2- (4-hydroxyphenyl) -7-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Sakuranetin | + | |Common Name=&&Sakuranetin&& |
|CAS=2957-21-3 | |CAS=2957-21-3 | ||
|KNApSAcK=C00000999 | |KNApSAcK=C00000999 | ||
}} | }} | ||
Latest revision as of 18:21, 8 October 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FCA Sakuranetin (7 pages) : FL2FCANS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2957-21-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FCANS0001.mol |
| Sakuranetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-5-hydroxy-2- (4-hydroxyphenyl) -7-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H14O5 |
| Exact Mass | 286.084123558 |
| Average Mass | 286.27936 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C[C@]([H])1c(c2)ccc(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
