LBF16000HO06
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0349 | |LipidBank=DFA0349 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0349 |
LipidMaps | LMFA01050083 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16000HO06.mol |
3,12-dihydroxypalmitic acid | |
---|---|
Structural Information | |
Systematic Name | 3,12-Dihydroxyhexadecanoic acid |
Common Name |
|
Symbol | |
Formula | C16H32O4 |
Exact Mass | 288.23005951199997 |
Average Mass | 288.42287999999996 |
SMILES | CCCCC(O)CCCCCCCCC(O)CC(O)=O |
Physicochemical Information | |
Melting Point | 83-84°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in methanol and alcohol<<0441>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |