FLND29NS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)-4-Methoxydalbergione | + | |SysName= (R) -4-Methoxydalbergione |
| − | |Common Name=&&(R)-4-Methoxydalbergione&& | + | |Common Name=&& (R) -4-Methoxydalbergione&& |
|CAS=4646-86-0 | |CAS=4646-86-0 | ||
|KNApSAcK=C00002549 | |KNApSAcK=C00002549 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLND Dalbergione : FLND29 4,(3'),(5')-Hydroxydalbergione and O-methyl derivatives (1 pages) : FLND29NS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4646-86-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLND29NS0001.mol |
| (R) -4-Methoxydalbergione | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -4-Methoxydalbergione |
| Common Name |
|
| Symbol | |
| Formula | C16H14O3 |
| Exact Mass | 254.094294314 |
| Average Mass | 254.28056 |
| SMILES | COc(c2)c(=O)cc(c(=O)2)[C@]([H])(C=C)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
