FLIE3ANS0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=8,12-Dihydroxy-7-methoxycoumestan |
| − | |Common Name= | + | |Common Name=&&4,9-Dihydroxy-3-methoxycoumestan&&Sativol&&8,12-Dihydroxy-7-methoxycoumestan&& |
|CAS=7331-58-0 | |CAS=7331-58-0 | ||
|KNApSAcK=C00009764 | |KNApSAcK=C00009764 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIE Coumestan : FLIE3A 3,4,9-Trihydroxycoumestan and O-methyl derivatives (1 pages) : FLIE3ANS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 7331-58-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE3ANS0001.mol |
| 4,9-Dihydroxy-3-methoxycoumestan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8,12-Dihydroxy-7-methoxycoumestan |
| Common Name |
|
| Symbol | |
| Formula | C16H10O6 |
| Exact Mass | 298.047738052 |
| Average Mass | 298.24699999999996 |
| SMILES | COc(c4)c(O)c(O3)c(c4)c(o1)c(C(=O)3)c(c2)c(cc(O)c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
