FLIE1LNS0003
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=7-Hydroxy-10,12-dimethoxycoumestan |
| − | |Common Name= | + | |Common Name=&&3-Hydroxy-7,9-dimethoxycoumestan&&Wairol&&7-Hydroxy-10,12-dimethoxycoumestan&& |
|CAS=77331-73-8 | |CAS=77331-73-8 | ||
|KNApSAcK=C00009767 | |KNApSAcK=C00009767 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIE Coumestan : FLIE1L 3,7,(8),9,(10)-Hydroxycoumestan O-methyl derivatives (2 pages) : FLIE1LNS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77331-73-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE1LNS0003.mol |
| 3-Hydroxy-7,9-dimethoxycoumestan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-10,12-dimethoxycoumestan |
| Common Name |
|
| Symbol | |
| Formula | C17H12O6 |
| Exact Mass | 312.063388116 |
| Average Mass | 312.27358 |
| SMILES | COc(c4)cc(o1)c(c(OC)4)c(C(=O)2)c1c(c3)c(cc(O)c3)O2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
