FL5FEANS0005
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 32520-55-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FEANS0005.mol |
6-Methoxykaempferol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6-Methoxykaempferol&&3,5,7,4'-Tetrahydroxy-6-methoxyflavone&&3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C16H12O7 |
Exact Mass | 316.058302738 |
Average Mass | 316.26228000000003 |
SMILES | COc(c(O)3)c(O)c(C(=O)1)c(c3)OC(c(c2)ccc(O)c2)=C(O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |