FL5FDANS0003
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=5-Hydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,4'-Dihydroxy-3,7-dimethoxyflavone&&Jaranol&&Kaempferol 3,7-O-dimethyl ether&&Kumatakenin&&Kumatakillin&&5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,4'-Dihydroxy-3,7-dimethoxyflavone&&Jaranol&&Kaempferol 3,7-O-dimethyl ether&&Kumatakenin&&Kumatakillin&&5-Hydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=3301-49-3 | |CAS=3301-49-3 | ||
|KNApSAcK=C00004569 | |KNApSAcK=C00004569 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDA Kaempferol O-methyl derivatives (4'-hydroxy, without FL5FBA, FL5FCA) (22 pages) : FL5FDANS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3301-49-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDANS0003.mol |
| 5,4'-Dihydroxy-3,7-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(OC)=C1c(c2)ccc(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
