FL4DA9NS0001
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R)-2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one | + | |SysName= (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one |
| − | |Common Name=&&Pinobanksin | + | |Common Name=&&Pinobanksin&& |
|CAS=548-82-3 | |CAS=548-82-3 | ||
|KNApSAcK=C00000991 | |KNApSAcK=C00000991 | ||
}} | }} | ||
Latest revision as of 17:14, 1 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DA9 5,7,(3'),(5')-Hydroxydihydroflavonol and O-methyl derivatives (25 pages) : FL4DA9NS Simple substitution (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 548-82-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DA9NS0001.mol |
| Pinobanksin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2,3-Dihydro-3beta,5,7-trihydroxy-2alpha-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O5 |
| Exact Mass | 272.068473494 |
| Average Mass | 272.25278000000003 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C([H])(O)C([H])1c(c2)cccc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
