FL3FRNND0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=5a,6-Dihydro-1,3,8-trihydroxy-5,5,11,11-tetramethyl-5H,7H,11H-benzofuro[3,4-bc]pyrano[3,2-h]xanthen-7-one |
|Common Name=&&Cycloartobiloxanthone&&5a,6-Dihydro-1,3,8-trihydroxy-5,5,11,11-tetramethyl-5H,7H,11H-benzofuro[3,4-bc]pyrano[3,2-h]xanthen-7-one&& | |Common Name=&&Cycloartobiloxanthone&&5a,6-Dihydro-1,3,8-trihydroxy-5,5,11,11-tetramethyl-5H,7H,11H-benzofuro[3,4-bc]pyrano[3,2-h]xanthen-7-one&& | ||
|CAS=121748-26-3 | |CAS=121748-26-3 | ||
|KNApSAcK=C00013485 | |KNApSAcK=C00013485 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 121748-26-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FRNND0001.mol |
Cycloartobiloxanthone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C25H22O7 |
Exact Mass | 434.136553058 |
Average Mass | 434.43798000000004 |
SMILES | O(c45)C(c32)=C(C(=O)c(c(cc(O6)c(C=CC6(C)C)5)O)4)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|