FL3FECNS0020
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=2-(3,4-Dihydroxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
|Common Name=&&3',4'-Dihydroxy-5,6,7-trimethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&3',4'-Dihydroxy-5,6,7-trimethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=51145-79-0 | |CAS=51145-79-0 | ||
|KNApSAcK=C00013317 | |KNApSAcK=C00013317 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 51145-79-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNS0020.mol |
| 3',4'-Dihydroxy-5,6,7-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-(3,4-Dihydroxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c1OC)c(O2)c(C(=O)C=C2c(c3)cc(O)c(O)c3)c(c1OC)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
