FL3FECNS0002
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (3,4-Dimethoxyphenyl) -5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one |
| − | + | |Common Name=&&Eupatilin&&5,7-Dihydroxy-3',4',6-trimethoxyflavone&& | |
|CAS=22368-21-4 | |CAS=22368-21-4 | ||
|KNApSAcK=C00003845 | |KNApSAcK=C00003845 | ||
}} | }} | ||
Latest revision as of 16:14, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEC 6-Hydroxyluteolin and O-methyl derivatives (85 pages) : FL3FECNS Simple substitution (32 pages) : FL3FECNS0 Normal (23 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 22368-21-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNS0002.mol |
| Eupatilin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dimethoxyphenyl) -5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c1OC)(O)cc(O2)c(C(=O)C=C2c(c3)cc(OC)c(OC)c3)c1O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
