FL3FA9NS0002
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one | |SysName=5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one | ||
| − | |Common Name=&&Chrysin&&5,7-Dihydroxyflavone | + | |Common Name=&&Chrysin&&5,7-Dihydroxyflavone&& |
|CAS=480-40-0 | |CAS=480-40-0 | ||
|KNApSAcK=C00003794 | |KNApSAcK=C00003794 | ||
}} | }} | ||
Latest revision as of 16:08, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA9 5,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (53 pages) : FL3FA9NS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 480-40-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9NS0002.mol |
| Chrysin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H10O4 |
| Exact Mass | 254.05790880799998 |
| Average Mass | 254.2375 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C=C1c(c2)cccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
