FL1C1ANI0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=(E)-1-[2-Hydroxy-4-methoxy-3-(2-hydroperoxy-3-methyl-3-butenyl)phenyl]-3-(4-hydroxyphenyl)-2-propen-1-one |
|Common Name=&&Xanthoangelol E&& | |Common Name=&&Xanthoangelol E&& | ||
|CAS=132998-84-6 | |CAS=132998-84-6 | ||
|KNApSAcK=C00007066 | |KNApSAcK=C00007066 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 132998-84-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1C1ANI0006.mol |
Xanthoangelol E | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C21H22O6 |
Exact Mass | 370.141638436 |
Average Mass | 370.39578 |
SMILES | Oc(c2)ccc(c2)C=CC(c(c1O)ccc(c1CC(OO)C(C)=C)OC)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|