FL7AFAGL0001
From Metabolomics.JP
(Difference between revisions)
(Created page with "{{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=8- [ (2R,3S,4S) -2- (3,4-Dihydroxyphenyl) -3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-4-yl] -3- (beta-D-glucopyranosyloxy) ...") |
Latest revision as of 11:42, 4 December 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL7 Anthocyani(di)n : FL7A Anthocyani(di)n
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 753008-64-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AFAGL0001.mol |
| Catechin (4alpha-8) peralgonidin 3-O-beta-glucopyranoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8- [ (2R,3S,4S) -2- (3,4-Dihydroxyphenyl) -3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-4-yl] -3- (beta-D-glucopyranosyloxy) -5,7-dihydroxy-2- (4-hydroxyphenyl) -1-benzopyrylium |
| Common Name |
|
| Symbol | |
| Formula | C36H33O16 |
| Exact Mass | 721.176860008 |
| Average Mass | 721.63762 |
| SMILES | c(c7)c(ccc(O)7)c([o+1]1)c(OC(O6)C(C(C(C6CO)O)O)O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
