FLIE1ANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,9-Dihydroxycoumestan |
|Common Name=&&Coumestrol&&Cumestrol&&3,9-Dihydroxycoumestan&& | |Common Name=&&Coumestrol&&Cumestrol&&3,9-Dihydroxycoumestan&& | ||
|CAS=479-13-0 | |CAS=479-13-0 | ||
|KNApSAcK=C00002514 | |KNApSAcK=C00002514 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 479-13-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE1ANS0001.mol |
| Coumestrol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,9-Dihydroxycoumestan |
| Common Name |
|
| Symbol | |
| Formula | C15H8O5 |
| Exact Mass | 268.037173366 |
| Average Mass | 268.22102 |
| SMILES | Oc(c4)cc(O3)c(c4)c(o1)c(C(=O)3)c(c2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
