FLID1ANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=[6aR,11aR,(-)]-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol | |SysName=[6aR,11aR,(-)]-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol | ||
| − | |Common Name=&&(-)-Medicarpin&& | + | |Common Name=&&(-)-Medicarpin&&[6aR,11aR,(-)]-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol&& |
|CAS=32383-76-9 | |CAS=32383-76-9 | ||
|KNApSAcK=C00002547 | |KNApSAcK=C00002547 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 32383-76-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1ANS0001.mol |
| (-)-Medicarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [6aR,11aR,(-)]-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol |
| Common Name |
|
| Symbol | |
| Formula | C16H14O4 |
| Exact Mass | 270.089208936 |
| Average Mass | 270.27996 |
| SMILES | COc(c4)cc(O1)c(c4)C([H])(C2)C([H])1c(c3)c(cc(O)c3) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
