FL1C1ANF0002
From Metabolomics.JP
(Redirected from INCHI:ZRPXWNBCRBPVHB-WEVVVXLNSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANF Furanoflavonoid (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 84575-13-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANF0002.mol |
| Bakuchalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4",5"-Dihydro-4,2'-dihydroxy-5"- (2-hydroxy-isopropyl) furano [ 2",3":4',3' ] chalcone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | Oc(c3)ccc(c3)C=CC(c(c(O)2)ccc(c21)OC(C(C)(C)O)C1)= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
