FLID1ANI0003
From Metabolomics.JP
(Redirected from INCHI:ZFUZIYGRFSXEIQ-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID1A Demethylmedicarpin and O-methyl derivatives (26 pages) : FLID1ANI Non-cyclic prenyl substituted (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 74515-46-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1ANI0003.mol |
| Sandwicensin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aR,11aR) -9-Methoxy-10- (3-methylbut-2-enyl) -6a,11a-dihydro-6H- [1] benzofuro [3,2-c] chromen-3-ol |
| Common Name |
|
| Symbol | |
| Formula | C21H22O4 |
| Exact Mass | 338.151809192 |
| Average Mass | 338.39698 |
| SMILES | c(C24)(c(OC2c(c3OC4)ccc(O)c3)1)ccc(c1CC=C(C)C)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
