FL1C2ANP0003
From Metabolomics.JP
(Redirected from INCHI:WVCACLYXUHSEMC-RMKNXTFCSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C2A 4,2',4',5'-Tetrahydroxychalcone and O-methyl derivatives (2 pages) : FL1C2ANP Pyranoflavonoid (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 50886-58-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C2ANP0003.mol |
| Flemingin F | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Flemingin F |
| Common Name |
|
| Symbol | |
| Formula | C25H26O6 |
| Exact Mass | 422.172938564 |
| Average Mass | 422.47033999999996 |
| SMILES | O=C(C=Cc(c3)ccc(O)c3)c(c2)c(O)c(c1c2O)C=CC(O1)(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
