FL1C19NP0004
From Metabolomics.JP
(Redirected from INCHI:UKLAAWWFUMSUTQ-ACCUITESSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C19 (3),(5),2',4'-Hydroxychalcone and O-methyl derivatives (16 pages) : FL1C19NP Pyranoflavonoid (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 146959-79-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C19NP0004.mol |
| Spinochalcone C | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2'-Hydroxy-6",6"-dimethyl-3'-prenyl-pyrano [ 2",3":4',5' ] chalcone |
| Common Name |
|
| Symbol | |
| Formula | C25H26O3 |
| Exact Mass | 374.18819469799996 |
| Average Mass | 374.47213999999997 |
| SMILES | CC(C)(O1)C=Cc(c2)c1c(c(O)c2C(=O)C=Cc(c3)cccc3)CC=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
