FLII9CNM0001
From Metabolomics.JP
(Redirected from INCHI:RICORHDCMSYMOL-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLII 2-Arylbenzofuran : FLII9C 5,6,(3'),(5')-Hydroxy-2-phenylbenzofuran and O-methyl derivatives (0 pages) : FLII9CNM C-Methyl or C2/C3 substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 69470-93-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLII9CNM0001.mol |
| Parvifuran | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-6-methoxy-3-methyl-2-phenylbenzofuran |
| Common Name |
|
| Symbol | |
| Formula | C16H14O3 |
| Exact Mass | 254.094294314 |
| Average Mass | 254.28056 |
| SMILES | COc(c1)c(O)cc(c(C)2)c1oc(c(c3)cccc3)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
