FL3F29NF0002
From Metabolomics.JP
(Redirected from INCHI:OVAZJVLXWGEKHQ-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F29 6,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (5 pages) : FL3F29NF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1094-12-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F29NF0002.mol |
| Kanjone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-Methoxy-2-phenyl-4H-furo [ 2,3-h ] -1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H12O4 |
| Exact Mass | 292.073558872 |
| Average Mass | 292.28548 |
| SMILES | c(c2OC)c(C(=O)4)c(OC(=C4)c(c3)cccc3)c(c21)cco1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
