FL1C19NF0003
From Metabolomics.JP
(Redirected from INCHI:NEHCUOFNXQUQDO-OUKQBFOZSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C19 (3),(5),2',4'-Hydroxychalcone and O-methyl derivatives (16 pages) : FL1C19NF Furanoflavonoid (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 86293-24-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C19NF0003.mol |
| Purpuritenin B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Purpuritenin B |
| Common Name |
|
| Symbol | |
| Formula | C19H16O3 |
| Exact Mass | 292.109944378 |
| Average Mass | 292.32854 |
| SMILES | C(c(c3OC)ccc(c32)occ2)(=O)C(C)=Cc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
