FLIJ1ANS0003
From Metabolomics.JP
(Redirected from INCHI:MSNJGHGEOPDPGD-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIJ alpha-Methoxynbenzoin : FLIJ1A Angolensin and O-methyl derivatives (4 pages) : FLIJ1ANS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 75946-85-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIJ1ANS0003.mol |
| 4-O-Methylangolensin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ R, (-) ] -1- (2-Dihydroxyphenyl-4-O-Methyl) -2- (4-methoxyphenyl) -1-propanone |
| Common Name |
|
| Symbol | |
| Formula | C17H18O4 |
| Exact Mass | 286.120509064 |
| Average Mass | 286.32241999999997 |
| SMILES | COc(c2)ccc(c2)C(C)C(=O)c(c1)c(O)cc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
