FL3FECNS0015
From Metabolomics.JP
(Redirected from INCHI:LYLDPYNWDVVPIQ-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEC 6-Hydroxyluteolin and O-methyl derivatives (85 pages) : FL3FECNS Simple substitution (32 pages) : FL3FECNS0 Normal (23 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 21764-09-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNS0015.mol |
| 6-Hydroxyluteolin 5,6,7,4'-tetramethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3'-Hydroxy-5,6,7,4'-tetramethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(c1OC)c(O2)c(C(=O)C=C2c(c3)cc(O)c(OC)c3)c(c1OC)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
