FLIAFLNS0002
From Metabolomics.JP
(Redirected from INCHI:LOLNVJIGYUJCIY-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAFL 5,7,8,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (4 pages) : FLIAFLNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 104363-16-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAFLNS0002.mol |
| 5,7,8,2',4'-Pentahydroxyisoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8,2',4'-Pentahydroxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C15H10O7 |
| Exact Mass | 302.042652674 |
| Average Mass | 302.2357 |
| SMILES | Oc(c3)cc(O)c(c3)C(=C2)C(=O)c(c(O)1)c(O2)c(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
