FL2FECNS0008
From Metabolomics.JP
(Redirected from INCHI:HFKPIRGXRKMHJS-AWEZNQCLSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FEC 6-Hydroxyeriodictol and O-methyl derivatives (8 pages) : FL2FECNS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 104193-93-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FECNS0008.mol |
| (2S) -5,6,7,3',4'-Pentamethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -5,6,7,3',4'-Pentamethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H22O7 |
| Exact Mass | 374.136553058 |
| Average Mass | 374.38448000000005 |
| SMILES | c(C(=O)1)(c3OC)c(cc(c3OC)OC)OC(c(c2)cc(c(c2)OC)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
