FL1C3CNS0001
From Metabolomics.JP
(Redirected from INCHI:GSBNFGRTUCCBTK-DAFODLJHSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C3C Okanin and O-methyl derivatives (29 pages) : FL1C3CNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 484-76-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C3CNS0001.mol |
| Okanin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -3- (3,4-Dihydroxyphenyl) -1- (2,3,4-trihydroxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c2)c(O)cc(c2)C=CC(=O)c(c1)c(O)c(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
