FLIH1LNS0001
From Metabolomics.JP
(Redirected from INCHI:CSQQQDLQNMHAPD-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIH 3-Arylcoumarin : FLIH1L (4),7,2',(3'),4',(5'),(6')-Hydroxy-3-phenylcoumarin and O-methyl derivatives (2 pages) : FLIH1LNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 54300-95-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIH1LNS0001.mol |
| 7,2'-Dihydroxy-4'-methoxy-3-phenylcoumarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,2'-Dihydroxy-4'-methoxy-3-phenylcoumarin |
| Common Name |
|
| Symbol | |
| Formula | C16H12O5 |
| Exact Mass | 284.068473494 |
| Average Mass | 284.26348 |
| SMILES | COc(c3)cc(O)c(c3)C(=C1)C(=O)Oc(c2)c(ccc(O)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
