FLID3ANS0002
From Metabolomics.JP
(Redirected from INCHI:CLHTZHIBHTWFEM-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID3A 3,4,9-Trihydroxypterocarpane and O-methyl derivatives (5 pages) : FLID3ANS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61255-58-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID3ANS0002.mol |
| 4-Hydroxydemethylmedicarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4,9-Trihydroxypterocarpan |
| Common Name |
|
| Symbol | |
| Formula | C15H12O5 |
| Exact Mass | 272.068473494 |
| Average Mass | 272.25278000000003 |
| SMILES | Oc(c4)cc(O1)c(c4)C(C3)C1c(c2)c(O3)c(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
