FL1C19NI0001
From Metabolomics.JP
(Redirected from INCHI:CHWWSUSAPRACBZ-FMIVXFBMSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C19 (3),(5),2',4'-Hydroxychalcone and O-methyl derivatives (16 pages) : FL1C19NI Non-cyclic prenyl substituted (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 52601-05-5;51619-57-9;55332-93-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C19NI0001.mol |
| Isocordoin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2E) -1- [ 2,4-Dihydroxy-3- (3-methyl-2-butenyl) phenyl ] -3-phenyl-2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O3 |
| Exact Mass | 308.141244506 |
| Average Mass | 308.371 |
| SMILES | c(c(C(=O)C=Cc(c2)cccc2)1)cc(O)c(c(O)1)CC=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
