FL1CA9NP0006
From Metabolomics.JP
(Redirected from INCHI:ADEFODYSLAAMOM-MDZDMXLPSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CA9 (3),(5),2',4',6'-Hydroxychalcone (39 pages) : FL1CA9NP Pyranoflavonoid (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 20890-68-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NP0006.mol |
| 2',4'-Dihydroxy-3',6",6"-trimethylpyrano [ 2",3":6',5' ] chalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-3',6",6"-trimethylpyrano [ 2",3":6',5' ] chalcone |
| Common Name |
|
| Symbol | |
| Formula | C21H20O4 |
| Exact Mass | 336.136159128 |
| Average Mass | 336.38109999999995 |
| SMILES | c(c23)(OC(C=C3)(C)C)c(c(c(c(O)2)C)O)C(=O)C=Cc(c1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
