FLID1ANP0006
From Metabolomics.JP
(Redirected from CAS:998755-24-9)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID1A Demethylmedicarpin and O-methyl derivatives (26 pages) : FLID1ANP Pyranoflavonoid (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 998755-24-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1ANP0006.mol |
| Isoneorautenol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aR,13aR) -6a,13a-Dihydro-10,10-dimethyl-6H,10H-furo [3,2-c:4,5-g'] bis [1] benzopyran-3-ol |
| Common Name |
|
| Symbol | |
| Formula | C20H18O4 |
| Exact Mass | 322.120509064 |
| Average Mass | 322.35452 |
| SMILES | C(c35)(C(Oc3cc(c4c5)OC(C=C4)(C)C)1)COc(c2)c1ccc(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
